C15H17BN2O2 — CID 56973168
2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarbonitrile (PubChem CID 56973168) has the molecular formula C15H17BN2O2 and a molecular weight of 268.12 g/mol. Its IUPAC name is 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 56973168 |
| Molecular Formula | C15H17BN2O2 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarbonitrile |
| SMILES | Cc1c(C#N)cc(B2OC(C)(C)C(C)(C)O2)cc1C#N |
| InChI | InChI=1S/C15H17BN2O2/c1-10-11(8-17)6-13(7-12(10)9-18)16-19-14(2,3)15(4,5)20-16/h6-7H,1-5H3 |
| InChIKey | HVHSNHGPIINTRT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|