C13H15BN2O4 — CID 75486554
2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 75486554) has the molecular formula C13H15BN2O4 and a molecular weight of 274.09 g/mol. Its IUPAC name is 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 75486554 |
| Molecular Formula | C13H15BN2O4 |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2ccc(C#N)c([N+](=O)[O-])c2)OC1(C)C |
| InChI | InChI=1S/C13H15BN2O4/c1-12(2)13(3,4)20-14(19-12)10-6-5-9(8-15)11(7-10)16(17)18/h5-7H,1-4H3 |
| InChIKey | VXZHLYDQNKIINO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|