C16H17BN2O3 — CID 170741876
1-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinoline-4-carbonitrile (PubChem CID 170741876) has the molecular formula C16H17BN2O3 and a molecular weight of 296.14 g/mol. Its IUPAC name is 1-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinoline-4-carbonitrile.
| Compound Name | 1-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 170741876 |
| Molecular Formula | C16H17BN2O3 |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinoline-4-carbonitrile |
| SMILES | CC1(C)OB(c2ccc3c(=O)[nH]cc(C#N)c3c2)OC1(C)C |
| InChI | InChI=1S/C16H17BN2O3/c1-15(2)16(3,4)22-17(21-15)11-5-6-12-13(7-11)10(8-18)9-19-14(12)20/h5-7,9H,1-4H3,(H,19,20) |
| InChIKey | ZNYNMBRKIREDLZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|