C15H17BClNO3 — CID 176669343
6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one (PubChem CID 176669343) has the molecular formula C15H17BClNO3 and a molecular weight of 305.57 g/mol. Its IUPAC name is 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one.
| Compound Name | 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 176669343 |
| Molecular Formula | C15H17BClNO3 |
| Molecular Weight | 305.57 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one |
| SMILES | CC1(C)OB(c2c[nH]c(=O)c3ccc(Cl)cc23)OC1(C)C |
| InChI | InChI=1S/C15H17BClNO3/c1-14(2)15(3,4)21-16(20-14)12-8-18-13(19)10-6-5-9(17)7-11(10)12/h5-8H,1-4H3,(H,18,19) |
| InChIKey | CJUUOFGLSPRQFX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|