C30H50B4O8 — CID 66897544
4,4,5,5-tetramethyl-2-[2,4,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 66897544) has the molecular formula C30H50B4O8 and a molecular weight of 581.97 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2,4,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2,4,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 66897544 |
| Molecular Formula | C30H50B4O8 |
| Molecular Weight | 581.97 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2,4,5-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(B3OC(C)(C)C(C)(C)O3)c(B3OC(C)(C)C(C)(C)O3)cc2B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C30H50B4O8/c1-23(2)24(3,4)36-31(35-23)19-17-21(33-39-27(9,10)28(11,12)40-33)22(34-41-29(13,14)30(15,16)42-34)18-20(19)32-37-25(5,6)26(7,8)38-32/h17-18H,1-16H3 |
| InChIKey | ONAIUNJQSUOIMG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|