C36H48B2O4 — CID 162400731
2-[5-[5-[2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,4-dimethylphenyl]-2,4-dimethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162400731) has the molecular formula C36H48B2O4 and a molecular weight of 566.40 g/mol. Its IUPAC name is 2-[5-[5-[2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,4-dimethylphenyl]-2,4-dimethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[5-[5-[2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,4-dimethylphenyl]-2,4-dimethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162400731 |
| Molecular Formula | C36H48B2O4 |
| Molecular Weight | 566.40 g/mol |
| Exact Mass | 566.37 |
| IUPAC Name | 2-[5-[5-[2,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,4-dimethylphenyl]-2,4-dimethylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(C)c(-c2cc(-c3cc(B4OC(C)(C)C(C)(C)O4)c(C)cc3C)c(C)cc2C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C36H48B2O4/c1-21-15-22(2)28(30-20-32(26(6)17-24(30)4)38-41-35(11,12)36(13,14)42-38)18-27(21)29-19-31(25(5)16-23(29)3)37-39-33(7,8)34(9,10)40-37/h15-20H,1-14H3 |
| InChIKey | JUGAHECRCUFKRM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.40 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|