C16H21BO3 — CID 166609780
2-(3,5-dimethyl-1-benzofuran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 166609780) has the molecular formula C16H21BO3 and a molecular weight of 272.15 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-benzofuran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3,5-dimethyl-1-benzofuran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 166609780 |
| Molecular Formula | C16H21BO3 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-(3,5-dimethyl-1-benzofuran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc2c(C)coc2cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H21BO3/c1-10-7-12-11(2)9-18-14(12)8-13(10)17-19-15(3,4)16(5,6)20-17/h7-9H,1-6H3 |
| InChIKey | KEZFVYNVKOQRRC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|