C18H24BNO4 — CID 163411000
N,N,5-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxamide (PubChem CID 163411000) has the molecular formula C18H24BNO4 and a molecular weight of 329.21 g/mol. Its IUPAC name is N,N,5-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxamide.
| Compound Name | N,N,5-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 163411000 |
| Molecular Formula | C18H24BNO4 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N,N,5-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc2cc(C(=O)N(C)C)oc2cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H24BNO4/c1-11-8-12-9-15(16(21)20(6)7)22-14(12)10-13(11)19-23-17(2,3)18(4,5)24-19/h8-10H,1-7H3 |
| InChIKey | PSVUOUHVGJBUNQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|