C23H25BO5 — CID 68716354
[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] 1-benzofuran-2-carboxylate (PubChem CID 68716354) has the molecular formula C23H25BO5 and a molecular weight of 392.26 g/mol. Its IUPAC name is [2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 68716354 |
| Molecular Formula | C23H25BO5 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] 1-benzofuran-2-carboxylate |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1OC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H25BO5/c1-14-11-17(24-28-22(3,4)23(5,6)29-24)12-15(2)20(14)27-21(25)19-13-16-9-7-8-10-18(16)26-19/h7-13H,1-6H3 |
| InChIKey | IODIWKHNFNRQFY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|