C19H31B2NO5S — CID 134128547
N,N-dimethyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxamide (PubChem CID 134128547) has the molecular formula C19H31B2NO5S and a molecular weight of 407.15 g/mol. Its IUPAC name is N,N-dimethyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxamide.
| Compound Name | N,N-dimethyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 134128547 |
| Molecular Formula | C19H31B2NO5S |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N,N-dimethyl-2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxamide |
| SMILES | CN(C)C(=O)c1cc(B2OC(C)(C)C(C)(C)O2)sc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H31B2NO5S/c1-16(2)17(3,4)25-20(24-16)13-11-12(15(23)22(9)10)14(28-13)21-26-18(5,6)19(7,8)27-21/h11H,1-10H3 |
| InChIKey | PPEZWPFHWRUBCW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|