C14H21BO4S — CID 175030972
ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate (PubChem CID 175030972) has the molecular formula C14H21BO4S and a molecular weight of 296.20 g/mol. Its IUPAC name is ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 175030972 |
| Molecular Formula | C14H21BO4S |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)sc1C |
| InChI | InChI=1S/C14H21BO4S/c1-7-17-12(16)10-8-11(20-9(10)2)15-18-13(3,4)14(5,6)19-15/h8H,7H2,1-6H3 |
| InChIKey | CSAADQDLTXCUPN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|