C17H24BNO5 — CID 131323291
ethyl 5-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 131323291) has the molecular formula C17H24BNO5 and a molecular weight of 333.19 g/mol. Its IUPAC name is ethyl 5-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | ethyl 5-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 131323291 |
| Molecular Formula | C17H24BNO5 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl 5-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CCOC(=O)c1cc(NC(C)=O)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H24BNO5/c1-7-22-15(21)13-10-12(19-11(2)20)8-9-14(13)18-23-16(3,4)17(5,6)24-18/h8-10H,7H2,1-6H3,(H,19,20) |
| InChIKey | QKKUGVAPBUYFDD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|