C15H19BF3NO3 — CID 171393278
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 171393278) has the molecular formula C15H19BF3NO3 and a molecular weight of 329.13 g/mol. Its IUPAC name is N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 171393278 |
| Molecular Formula | C15H19BF3NO3 |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19BF3NO3/c1-9(21)20-10-6-7-12(11(8-10)15(17,18)19)16-22-13(2,3)14(4,5)23-16/h6-8H,1-5H3,(H,20,21) |
| InChIKey | CETNOZYNAURHFH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|