C20H29BF3NO5 — CID 146026892
tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenoxy]ethyl]carbamate (PubChem CID 146026892) has the molecular formula C20H29BF3NO5 and a molecular weight of 431.26 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 146026892 |
| Molecular Formula | C20H29BF3NO5 |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(B2OC(C)(C)C(C)(C)O2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H29BF3NO5/c1-17(2,3)28-16(26)25-10-11-27-13-8-9-15(14(12-13)20(22,23)24)21-29-18(4,5)19(6,7)30-21/h8-9,12H,10-11H2,1-7H3,(H,25,26) |
| InChIKey | GWGNCPWRPOHCBB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|