C19H29BFNO5 — CID 162438360
tert-butyl N-[2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate (PubChem CID 162438360) has the molecular formula C19H29BFNO5 and a molecular weight of 381.25 g/mol. Its IUPAC name is tert-butyl N-[2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 162438360 |
| Molecular Formula | C19H29BFNO5 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl N-[2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(F)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H29BFNO5/c1-17(2,3)25-16(23)22-10-11-24-15-9-8-13(21)12-14(15)20-26-18(4,5)19(6,7)27-20/h8-9,12H,10-11H2,1-7H3,(H,22,23) |
| InChIKey | TYHYTMKAKCEEEJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|