C22H34BNO6 — CID 172851682
tert-butyl N-[3-[4-acetyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamate (PubChem CID 172851682) has the molecular formula C22H34BNO6 and a molecular weight of 419.33 g/mol. Its IUPAC name is tert-butyl N-[3-[4-acetyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-acetyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 172851682 |
| Molecular Formula | C22H34BNO6 |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | tert-butyl N-[3-[4-acetyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamate |
| SMILES | CC(=O)c1ccc(OCCCNC(=O)OC(C)(C)C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34BNO6/c1-15(25)17-11-10-16(27-13-9-12-24-19(26)28-20(2,3)4)14-18(17)23-29-21(5,6)22(7,8)30-23/h10-11,14H,9,12-13H2,1-8H3,(H,24,26) |
| InChIKey | YDQYIBJYWSHTHD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|