C19H31FN2O3S — CID 145224630
tert-butyl N-[2-[2-[1-(tert-butylsulfanylamino)ethyl]-4-fluorophenoxy]ethyl]carbamate (PubChem CID 145224630) has the molecular formula C19H31FN2O3S and a molecular weight of 386.53 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[1-(tert-butylsulfanylamino)ethyl]-4-fluorophenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[1-(tert-butylsulfanylamino)ethyl]-4-fluorophenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 145224630 |
| Molecular Formula | C19H31FN2O3S |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | tert-butyl N-[2-[2-[1-(tert-butylsulfanylamino)ethyl]-4-fluorophenoxy]ethyl]carbamate |
| SMILES | CC(NSC(C)(C)C)c1cc(F)ccc1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31FN2O3S/c1-13(22-26-19(5,6)7)15-12-14(20)8-9-16(15)24-11-10-21-17(23)25-18(2,3)4/h8-9,12-13,22H,10-11H2,1-7H3,(H,21,23) |
| InChIKey | AHIIYKJIDMFQKJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|