C17H26FNO3 — CID 145230413
tert-butyl N-[2-(4-fluoro-2-propan-2-ylphenoxy)propyl]carbamate (PubChem CID 145230413) has the molecular formula C17H26FNO3 and a molecular weight of 311.40 g/mol. Its IUPAC name is tert-butyl N-[2-(4-fluoro-2-propan-2-ylphenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-fluoro-2-propan-2-ylphenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 145230413 |
| Molecular Formula | C17H26FNO3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | tert-butyl N-[2-(4-fluoro-2-propan-2-ylphenoxy)propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)Oc1ccc(F)cc1C(C)C |
| InChI | InChI=1S/C17H26FNO3/c1-11(2)14-9-13(18)7-8-15(14)21-12(3)10-19-16(20)22-17(4,5)6/h7-9,11-12H,10H2,1-6H3,(H,19,20) |
| InChIKey | XOGPBGADKYFTEQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |