C15H21FN2O5 — CID 58413304
tert-butyl N-[3-(5-fluoro-2-nitrophenoxy)butyl]carbamate (PubChem CID 58413304) has the molecular formula C15H21FN2O5 and a molecular weight of 328.34 g/mol. Its IUPAC name is tert-butyl N-[3-(5-fluoro-2-nitrophenoxy)butyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-fluoro-2-nitrophenoxy)butyl]carbamate |
|---|---|
| PubChem CID | 58413304 |
| Molecular Formula | C15H21FN2O5 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | tert-butyl N-[3-(5-fluoro-2-nitrophenoxy)butyl]carbamate |
| SMILES | CC(CCNC(=O)OC(C)(C)C)Oc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21FN2O5/c1-10(7-8-17-14(19)23-15(2,3)4)22-13-9-11(16)5-6-12(13)18(20)21/h5-6,9-10H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | SLCWOLNXICYWRT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|