C20H32BNO6 — CID 15553237
tert-butyl N-[4-(ethoxymethoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 15553237) has the molecular formula C20H32BNO6 and a molecular weight of 393.29 g/mol. Its IUPAC name is tert-butyl N-[4-(ethoxymethoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(ethoxymethoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 15553237 |
| Molecular Formula | C20H32BNO6 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | tert-butyl N-[4-(ethoxymethoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | CCOCOc1ccc(NC(=O)OC(C)(C)C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H32BNO6/c1-9-24-13-25-16-11-10-14(22-17(23)26-18(2,3)4)12-15(16)21-27-19(5,6)20(7,8)28-21/h10-12H,9,13H2,1-8H3,(H,22,23) |
| InChIKey | ODGLEVBOQOLHPI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|