C25H32BNO4 — CID 177164578
tert-butyl N-[3-(1-phenylethenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 177164578) has the molecular formula C25H32BNO4 and a molecular weight of 421.35 g/mol. Its IUPAC name is tert-butyl N-[3-(1-phenylethenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(1-phenylethenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 177164578 |
| Molecular Formula | C25H32BNO4 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | tert-butyl N-[3-(1-phenylethenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | C=C(c1ccccc1)c1cc(NC(=O)OC(C)(C)C)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H32BNO4/c1-17(18-12-10-9-11-13-18)20-16-19(27-22(28)29-23(2,3)4)14-15-21(20)26-30-24(5,6)25(7,8)31-26/h9-16H,1H2,2-8H3,(H,27,28) |
| InChIKey | MVBOUMAUEAIXNE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|