C34H43BBr2F3N3O6 — CID 158333363
4-bromo-3-fluoroaniline;tert-butyl N-(4-bromo-3-fluorophenyl)carbamate;tert-butyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 158333363) has the molecular formula C34H43BBr2F3N3O6 and a molecular weight of 817.35 g/mol. Its IUPAC name is 4-bromo-3-fluoroaniline;tert-butyl N-(4-bromo-3-fluorophenyl)carbamate;tert-butyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | 4-bromo-3-fluoroaniline;tert-butyl N-(4-bromo-3-fluorophenyl)carbamate;tert-butyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 158333363 |
| Molecular Formula | C34H43BBr2F3N3O6 |
| Molecular Weight | 817.35 g/mol |
| Exact Mass | 815.16 |
| IUPAC Name | 4-bromo-3-fluoroaniline;tert-butyl N-(4-bromo-3-fluorophenyl)carbamate;tert-butyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1.CC(C)(C)OC(=O)Nc1ccc(Br)c(F)c1.Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C17H25BFNO4.C11H13BrFNO2.C6H5BrFN/c1-15(2,3)22-14(21)20-11-8-9-12(13(19)10-11)18-23-16(4,5)17(6,7)24-18;1-11(2,3)16-10(15)14-7-4-5-8(12)9(13)6-7;7-5-2-1-4(9)3-6(5)8/h8-10H,1-7H3,(H,20,21);4-6H,1-3H3,(H,14,15);1-3H,9H2 |
| InChIKey | GQGXCICYHGMUHJ-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.35 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|