C18H21BrFN3O2 — CID 114199958
tert-butyl N-[4-amino-3-(5-bromo-4-fluoro-2-methylanilino)phenyl]carbamate (PubChem CID 114199958) has the molecular formula C18H21BrFN3O2 and a molecular weight of 410.29 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(5-bromo-4-fluoro-2-methylanilino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(5-bromo-4-fluoro-2-methylanilino)phenyl]carbamate |
|---|---|
| PubChem CID | 114199958 |
| Molecular Formula | C18H21BrFN3O2 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | tert-butyl N-[4-amino-3-(5-bromo-4-fluoro-2-methylanilino)phenyl]carbamate |
| SMILES | Cc1cc(F)c(Br)cc1Nc1cc(NC(=O)OC(C)(C)C)ccc1N |
| InChI | InChI=1S/C18H21BrFN3O2/c1-10-7-13(20)12(19)9-15(10)23-16-8-11(5-6-14(16)21)22-17(24)25-18(2,3)4/h5-9,23H,21H2,1-4H3,(H,22,24) |
| InChIKey | MSCINGNPZOLMAU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|