C13H13BrFN3O2S — CID 107590941
4-amino-3-(5-bromo-4-fluoro-2-methylanilino)benzenesulfonamide (PubChem CID 107590941) has the molecular formula C13H13BrFN3O2S and a molecular weight of 374.24 g/mol. Its IUPAC name is 4-amino-3-(5-bromo-4-fluoro-2-methylanilino)benzenesulfonamide.
| Compound Name | 4-amino-3-(5-bromo-4-fluoro-2-methylanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 107590941 |
| Molecular Formula | C13H13BrFN3O2S |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 4-amino-3-(5-bromo-4-fluoro-2-methylanilino)benzenesulfonamide |
| SMILES | Cc1cc(F)c(Br)cc1Nc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C13H13BrFN3O2S/c1-7-4-10(15)9(14)6-12(7)18-13-5-8(21(17,19)20)2-3-11(13)16/h2-6,18H,16H2,1H3,(H2,17,19,20) |
| InChIKey | KCXUQJVUMYPRNF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|