C12H10ClF2N3O2S — CID 83073033
4-amino-3-(2-chloro-4,6-difluoroanilino)benzenesulfonamide (PubChem CID 83073033) has the molecular formula C12H10ClF2N3O2S and a molecular weight of 333.75 g/mol. Its IUPAC name is 4-amino-3-(2-chloro-4,6-difluoroanilino)benzenesulfonamide.
| Compound Name | 4-amino-3-(2-chloro-4,6-difluoroanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 83073033 |
| Molecular Formula | C12H10ClF2N3O2S |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 4-amino-3-(2-chloro-4,6-difluoroanilino)benzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)cc1Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C12H10ClF2N3O2S/c13-8-3-6(14)4-9(15)12(8)18-11-5-7(21(17,19)20)1-2-10(11)16/h1-5,18H,16H2,(H2,17,19,20) |
| InChIKey | SAWHNTAPWHXBIW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|