C15H26N4O4S — CID 114199969
tert-butyl N-[4-amino-3-[2-(dimethylsulfamoyl)ethylamino]phenyl]carbamate (PubChem CID 114199969) has the molecular formula C15H26N4O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[2-(dimethylsulfamoyl)ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[2-(dimethylsulfamoyl)ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 114199969 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl N-[4-amino-3-[2-(dimethylsulfamoyl)ethylamino]phenyl]carbamate |
| SMILES | CN(C)S(=O)(=O)CCNc1cc(NC(=O)OC(C)(C)C)ccc1N |
| InChI | InChI=1S/C15H26N4O4S/c1-15(2,3)23-14(20)18-11-6-7-12(16)13(10-11)17-8-9-24(21,22)19(4)5/h6-7,10,17H,8-9,16H2,1-5H3,(H,18,20) |
| InChIKey | KVNIGCHMHXSRMS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|