C13H22N4O4S — CID 104932877
tert-butyl N-[2-(2-amino-5-sulfamoylanilino)ethyl]carbamate (PubChem CID 104932877) has the molecular formula C13H22N4O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is tert-butyl N-[2-(2-amino-5-sulfamoylanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-amino-5-sulfamoylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 104932877 |
| Molecular Formula | C13H22N4O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | tert-butyl N-[2-(2-amino-5-sulfamoylanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C13H22N4O4S/c1-13(2,3)21-12(18)17-7-6-16-11-8-9(22(15,19)20)4-5-10(11)14/h4-5,8,16H,6-7,14H2,1-3H3,(H,17,18)(H2,15,19,20) |
| InChIKey | RIVFIDMIHIGYMP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|