C15H24N4O4S — CID 176857876
tert-butyl N-[(E)-4-(2-amino-4-sulfamoylanilino)but-2-enyl]carbamate (PubChem CID 176857876) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-(2-amino-4-sulfamoylanilino)but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-(2-amino-4-sulfamoylanilino)but-2-enyl]carbamate |
|---|---|
| PubChem CID | 176857876 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | tert-butyl N-[(E)-4-(2-amino-4-sulfamoylanilino)but-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/CNc1ccc(S(N)(=O)=O)cc1N |
| InChI | InChI=1S/C15H24N4O4S/c1-15(2,3)23-14(20)19-9-5-4-8-18-13-7-6-11(10-12(13)16)24(17,21)22/h4-7,10,18H,8-9,16H2,1-3H3,(H,19,20)(H2,17,21,22)/b5-4+ |
| InChIKey | ZCUHWENUXLKFHW-SNAWJCMRSA-N |
| XLogP | 1.41 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|