C13H18IN3O5S — CID 10837460
tert-butyl N-[2-(2-iodo-4-sulfamoylanilino)-2-oxoethyl]carbamate (PubChem CID 10837460) has the molecular formula C13H18IN3O5S and a molecular weight of 455.27 g/mol. Its IUPAC name is tert-butyl N-[2-(2-iodo-4-sulfamoylanilino)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-iodo-4-sulfamoylanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 10837460 |
| Molecular Formula | C13H18IN3O5S |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | tert-butyl N-[2-(2-iodo-4-sulfamoylanilino)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccc(S(N)(=O)=O)cc1I |
| InChI | InChI=1S/C13H18IN3O5S/c1-13(2,3)22-12(19)16-7-11(18)17-10-5-4-8(6-9(10)14)23(15,20)21/h4-6H,7H2,1-3H3,(H,16,19)(H,17,18)(H2,15,20,21) |
| InChIKey | DXTOYRNZWVFCFG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|