C16H22N4O5 — CID 131999827
tert-butyl N-[(E)-4-(4-carbamoyl-2-nitroanilino)but-2-enyl]carbamate (PubChem CID 131999827) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-(4-carbamoyl-2-nitroanilino)but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-(4-carbamoyl-2-nitroanilino)but-2-enyl]carbamate |
|---|---|
| PubChem CID | 131999827 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | tert-butyl N-[(E)-4-(4-carbamoyl-2-nitroanilino)but-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/CNc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O5/c1-16(2,3)25-15(22)19-9-5-4-8-18-12-7-6-11(14(17)21)10-13(12)20(23)24/h4-7,10,18H,8-9H2,1-3H3,(H2,17,21)(H,19,22)/b5-4+ |
| InChIKey | TWUZXHCLAPAFEB-SNAWJCMRSA-N |
| XLogP | 2.19 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|