C18H25N3O6 — CID 154942348
ethyl 4-[[(E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]amino]-3-nitrobenzoate (PubChem CID 154942348) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is ethyl 4-[[(E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]amino]-3-nitrobenzoate.
| Compound Name | ethyl 4-[[(E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]amino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 154942348 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | ethyl 4-[[(E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]amino]-3-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc(NC/C=C/CNC(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H25N3O6/c1-5-26-16(22)13-8-9-14(15(12-13)21(24)25)19-10-6-7-11-20-17(23)27-18(2,3)4/h6-9,12,19H,5,10-11H2,1-4H3,(H,20,23)/b7-6+ |
| InChIKey | AUKZSVDUCRFGQH-VOTSOKGWSA-N |
| XLogP | 3.26 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|