C20H31N3O6 — CID 170945592
propan-2-yl 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]-3-nitrobenzoate (PubChem CID 170945592) has the molecular formula C20H31N3O6 and a molecular weight of 409.48 g/mol. Its IUPAC name is propan-2-yl 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]-3-nitrobenzoate.
| Compound Name | propan-2-yl 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 170945592 |
| Molecular Formula | C20H31N3O6 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | propan-2-yl 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]-3-nitrobenzoate |
| SMILES | CC(C)OC(=O)c1ccc(NCCCCCNC(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H31N3O6/c1-14(2)28-18(24)15-9-10-16(17(13-15)23(26)27)21-11-7-6-8-12-22-19(25)29-20(3,4)5/h9-10,13-14,21H,6-8,11-12H2,1-5H3,(H,22,25) |
| InChIKey | YMZALUBSPRXLQI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|