C15H23N3O4 — CID 15451622
tert-butyl N-[2-(4,5-dimethyl-2-nitroanilino)ethyl]carbamate (PubChem CID 15451622) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is tert-butyl N-[2-(4,5-dimethyl-2-nitroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4,5-dimethyl-2-nitroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 15451622 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl N-[2-(4,5-dimethyl-2-nitroanilino)ethyl]carbamate |
| SMILES | Cc1cc(NCCNC(=O)OC(C)(C)C)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H23N3O4/c1-10-8-12(13(18(20)21)9-11(10)2)16-6-7-17-14(19)22-15(3,4)5/h8-9,16H,6-7H2,1-5H3,(H,17,19) |
| InChIKey | RONCNAYONBDDSL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|