C14H21N3O5 — CID 104917337
tert-butyl N-[2-(3-methoxy-2-nitroanilino)ethyl]carbamate (PubChem CID 104917337) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is tert-butyl N-[2-(3-methoxy-2-nitroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-methoxy-2-nitroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 104917337 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | tert-butyl N-[2-(3-methoxy-2-nitroanilino)ethyl]carbamate |
| SMILES | COc1cccc(NCCNC(=O)OC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O5/c1-14(2,3)22-13(18)16-9-8-15-10-6-5-7-11(21-4)12(10)17(19)20/h5-7,15H,8-9H2,1-4H3,(H,16,18) |
| InChIKey | FSQSPWMGSWABRK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|