C14H18N4O4 — CID 103628271
tert-butyl N-[2-(2-cyano-4-nitroanilino)ethyl]carbamate (PubChem CID 103628271) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is tert-butyl N-[2-(2-cyano-4-nitroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-cyano-4-nitroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 103628271 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | tert-butyl N-[2-(2-cyano-4-nitroanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C14H18N4O4/c1-14(2,3)22-13(19)17-7-6-16-12-5-4-11(18(20)21)8-10(12)9-15/h4-5,8,16H,6-7H2,1-3H3,(H,17,19) |
| InChIKey | QIMCHEGAFBAKDN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|