C17H28N4O5S — CID 50742681
tert-butyl N-[2-(2-amino-4-morpholin-4-ylsulfonylanilino)ethyl]carbamate (PubChem CID 50742681) has the molecular formula C17H28N4O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is tert-butyl N-[2-(2-amino-4-morpholin-4-ylsulfonylanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-amino-4-morpholin-4-ylsulfonylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 50742681 |
| Molecular Formula | C17H28N4O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | tert-butyl N-[2-(2-amino-4-morpholin-4-ylsulfonylanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(S(=O)(=O)N2CCOCC2)cc1N |
| InChI | InChI=1S/C17H28N4O5S/c1-17(2,3)26-16(22)20-7-6-19-15-5-4-13(12-14(15)18)27(23,24)21-8-10-25-11-9-21/h4-5,12,19H,6-11,18H2,1-3H3,(H,20,22) |
| InChIKey | BVHLRHJUAUWHES-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|