C13H21N3O2S — CID 3433369
1-N-propyl-4-pyrrolidin-1-ylsulfonylbenzene-1,2-diamine (PubChem CID 3433369) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-N-propyl-4-pyrrolidin-1-ylsulfonylbenzene-1,2-diamine.
| Compound Name | 1-N-propyl-4-pyrrolidin-1-ylsulfonylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 3433369 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-N-propyl-4-pyrrolidin-1-ylsulfonylbenzene-1,2-diamine |
| SMILES | CCCNc1ccc(S(=O)(=O)N2CCCC2)cc1N |
| InChI | InChI=1S/C13H21N3O2S/c1-2-7-15-13-6-5-11(10-12(13)14)19(17,18)16-8-3-4-9-16/h5-6,10,15H,2-4,7-9,14H2,1H3 |
| InChIKey | RSRSIIAXIAYIKS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|