C18H24N4O2S — CID 67106571
1-N-benzyl-4-(4-methylpiperazin-1-yl)sulfonylbenzene-1,2-diamine (PubChem CID 67106571) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-N-benzyl-4-(4-methylpiperazin-1-yl)sulfonylbenzene-1,2-diamine.
| Compound Name | 1-N-benzyl-4-(4-methylpiperazin-1-yl)sulfonylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 67106571 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-N-benzyl-4-(4-methylpiperazin-1-yl)sulfonylbenzene-1,2-diamine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NCc3ccccc3)c(N)c2)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c1-21-9-11-22(12-10-21)25(23,24)16-7-8-18(17(19)13-16)20-14-15-5-3-2-4-6-15/h2-8,13,20H,9-12,14,19H2,1H3 |
| InChIKey | WYIMGTZEAORCSB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|