C23H31BN2O5 — CID 156717684
tert-butyl N-[3-[4-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]carbamate (PubChem CID 156717684) has the molecular formula C23H31BN2O5 and a molecular weight of 426.32 g/mol. Its IUPAC name is tert-butyl N-[3-[4-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 156717684 |
| Molecular Formula | C23H31BN2O5 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl N-[3-[4-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Oc2ccc(N)cc2B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C23H31BN2O5/c1-21(2,3)29-20(27)26-16-9-8-10-17(14-16)28-19-12-11-15(25)13-18(19)24-30-22(4,5)23(6,7)31-24/h8-14H,25H2,1-7H3,(H,26,27) |
| InChIKey | CDFOWTZHIGAQKH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|