C19H23BN2O5 — CID 172794040
[3-[4-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]carbamic acid (PubChem CID 172794040) has the molecular formula C19H23BN2O5 and a molecular weight of 370.21 g/mol. Its IUPAC name is [3-[4-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]carbamic acid.
| Compound Name | [3-[4-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]carbamic acid |
|---|---|
| PubChem CID | 172794040 |
| Molecular Formula | C19H23BN2O5 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [3-[4-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]phenyl]carbamic acid |
| SMILES | CC1(C)OB(c2cc(N)ccc2Oc2cccc(NC(=O)O)c2)OC1(C)C |
| InChI | InChI=1S/C19H23BN2O5/c1-18(2)19(3,4)27-20(26-18)15-10-12(21)8-9-16(15)25-14-7-5-6-13(11-14)22-17(23)24/h5-11,22H,21H2,1-4H3,(H,23,24) |
| InChIKey | PYNFVWQAYMASBM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|