C20H22BNO4S — CID 22139418
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-thioxanthen-2-yl]carbamic acid (PubChem CID 22139418) has the molecular formula C20H22BNO4S and a molecular weight of 383.28 g/mol. Its IUPAC name is [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-thioxanthen-2-yl]carbamic acid.
| Compound Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-thioxanthen-2-yl]carbamic acid |
|---|---|
| PubChem CID | 22139418 |
| Molecular Formula | C20H22BNO4S |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-thioxanthen-2-yl]carbamic acid |
| SMILES | CC1(C)OB(c2cccc3c2Sc2ccc(NC(=O)O)cc2C3)OC1(C)C |
| InChI | InChI=1S/C20H22BNO4S/c1-19(2)20(3,4)26-21(25-19)15-7-5-6-12-10-13-11-14(22-18(23)24)8-9-16(13)27-17(12)15/h5-9,11,22H,10H2,1-4H3,(H,23,24) |
| InChIKey | NHBPJFWWTMRQIY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|