C14H20BNO4 — CID 67351915
[5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid (PubChem CID 67351915) has the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. Its IUPAC name is [5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid.
| Compound Name | [5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 67351915 |
| Molecular Formula | C14H20BNO4 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)c(NC(=O)O)c1 |
| InChI | InChI=1S/C14H20BNO4/c1-9-6-7-10(11(8-9)16-12(17)18)15-19-13(2,3)14(4,5)20-15/h6-8,16H,1-5H3,(H,17,18) |
| InChIKey | SOAASRGJGASCKI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|