C18H25BN2O4 — CID 168926547
tert-butyl N-[5-cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (PubChem CID 168926547) has the molecular formula C18H25BN2O4 and a molecular weight of 344.22 g/mol. Its IUPAC name is tert-butyl N-[5-cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[5-cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 168926547 |
| Molecular Formula | C18H25BN2O4 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | tert-butyl N-[5-cyano-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C#N)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H25BN2O4/c1-16(2,3)23-15(22)21-14-10-12(11-20)8-9-13(14)19-24-17(4,5)18(6,7)25-19/h8-10H,1-7H3,(H,21,22) |
| InChIKey | WDEJUDOBQLVTNT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|