C12H15BN2O5 — CID 142785533
[4-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid (PubChem CID 142785533) has the molecular formula C12H15BN2O5 and a molecular weight of 278.07 g/mol. Its IUPAC name is [4-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid.
| Compound Name | [4-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid |
|---|---|
| PubChem CID | 142785533 |
| Molecular Formula | C12H15BN2O5 |
| Molecular Weight | 278.07 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [4-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C#N)ccc1OB(O)O |
| InChI | InChI=1S/C12H15BN2O5/c1-12(2,3)19-11(16)15-9-6-8(7-14)4-5-10(9)20-13(17)18/h4-6,17-18H,1-3H3,(H,15,16) |
| InChIKey | LJDJDFXWFYUSRU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.07 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|