C18H18N2O4 — CID 66818758
tert-butyl N-[3-(4-cyanophenoxy)-5-hydroxyphenyl]carbamate (PubChem CID 66818758) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is tert-butyl N-[3-(4-cyanophenoxy)-5-hydroxyphenyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-cyanophenoxy)-5-hydroxyphenyl]carbamate |
|---|---|
| PubChem CID | 66818758 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | tert-butyl N-[3-(4-cyanophenoxy)-5-hydroxyphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(O)cc(Oc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C18H18N2O4/c1-18(2,3)24-17(22)20-13-8-14(21)10-16(9-13)23-15-6-4-12(11-19)5-7-15/h4-10,21H,1-3H3,(H,20,22) |
| InChIKey | JVJOZIVYVSOAHV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |