C34H36N4O5 — CID 66819115
tert-butyl N-[4-[[3,5-bis[(4-cyanophenyl)methoxy]phenyl]carbamoyl]cyclohexyl]carbamate (PubChem CID 66819115) has the molecular formula C34H36N4O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is tert-butyl N-[4-[[3,5-bis[(4-cyanophenyl)methoxy]phenyl]carbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3,5-bis[(4-cyanophenyl)methoxy]phenyl]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 66819115 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | tert-butyl N-[4-[[3,5-bis[(4-cyanophenyl)methoxy]phenyl]carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C(=O)Nc2cc(OCc3ccc(C#N)cc3)cc(OCc3ccc(C#N)cc3)c2)CC1 |
| InChI | InChI=1S/C34H36N4O5/c1-34(2,3)43-33(40)38-28-14-12-27(13-15-28)32(39)37-29-16-30(41-21-25-8-4-23(19-35)5-9-25)18-31(17-29)42-22-26-10-6-24(20-36)7-11-26/h4-11,16-18,27-28H,12-15,21-22H2,1-3H3,(H,37,39)(H,38,40) |
| InChIKey | UXPPKFYDNCBFRR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |