C32H38N6O7 — CID 87166833
tert-butyl N-[4-[[3,5-bis[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]phenyl]carbamoyl]cyclohexyl]carbamate (PubChem CID 87166833) has the molecular formula C32H38N6O7 and a molecular weight of 618.69 g/mol. Its IUPAC name is tert-butyl N-[4-[[3,5-bis[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]phenyl]carbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3,5-bis[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]phenyl]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 87166833 |
| Molecular Formula | C32H38N6O7 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | tert-butyl N-[4-[[3,5-bis[4-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]phenyl]carbamoyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C(=O)Nc2cc(Oc3ccc(/C(N)=N/O)cc3)cc(Oc3ccc(/C(N)=N/O)cc3)c2)CC1 |
| InChI | InChI=1S/C32H38N6O7/c1-32(2,3)45-31(40)36-22-10-4-21(5-11-22)30(39)35-23-16-26(43-24-12-6-19(7-13-24)28(33)37-41)18-27(17-23)44-25-14-8-20(9-15-25)29(34)38-42/h6-9,12-18,21-22,41-42H,4-5,10-11H2,1-3H3,(H2,33,37)(H2,34,38)(H,35,39)(H,36,40) |
| InChIKey | OFXQXZYJCHQTIY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 203.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|