C33H37BrN4O7 — CID 91174601
tert-butyl N-[4-[[3-[4-[[acetyl(hydroxy)hydrazinylidene]methyl]phenoxy]-5-(4-bromophenoxy)benzoyl]amino]cyclohexyl]carbamate (PubChem CID 91174601) has the molecular formula C33H37BrN4O7 and a molecular weight of 681.58 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-[4-[[acetyl(hydroxy)hydrazinylidene]methyl]phenoxy]-5-(4-bromophenoxy)benzoyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-[4-[[acetyl(hydroxy)hydrazinylidene]methyl]phenoxy]-5-(4-bromophenoxy)benzoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 91174601 |
| Molecular Formula | C33H37BrN4O7 |
| Molecular Weight | 681.58 g/mol |
| Exact Mass | 680.18 |
| IUPAC Name | tert-butyl N-[4-[[3-[4-[[acetyl(hydroxy)hydrazinylidene]methyl]phenoxy]-5-(4-bromophenoxy)benzoyl]amino]cyclohexyl]carbamate |
| SMILES | CC(=O)N(O)N=Cc1ccc(Oc2cc(Oc3ccc(Br)cc3)cc(C(=O)NC3CCC(NC(=O)OC(C)(C)C)CC3)c2)cc1 |
| InChI | InChI=1S/C33H37BrN4O7/c1-21(39)38(42)35-20-22-5-13-27(14-6-22)43-29-17-23(18-30(19-29)44-28-15-7-24(34)8-16-28)31(40)36-25-9-11-26(12-10-25)37-32(41)45-33(2,3)4/h5-8,13-20,25-26,42H,9-12H2,1-4H3,(H,36,40)(H,37,41) |
| InChIKey | WHOMVISYKNHNIN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.58 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|