C36H43N5O8 — CID 87166983
tert-butyl N-[4-[[3-[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]-5-[4-(dimethylcarbamoyl)phenoxy]benzoyl]amino]cyclohexyl]carbamate (PubChem CID 87166983) has the molecular formula C36H43N5O8 and a molecular weight of 673.77 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]-5-[4-(dimethylcarbamoyl)phenoxy]benzoyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]-5-[4-(dimethylcarbamoyl)phenoxy]benzoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 87166983 |
| Molecular Formula | C36H43N5O8 |
| Molecular Weight | 673.77 g/mol |
| Exact Mass | 673.31 |
| IUPAC Name | tert-butyl N-[4-[[3-[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]-5-[4-(dimethylcarbamoyl)phenoxy]benzoyl]amino]cyclohexyl]carbamate |
| SMILES | [H]/N=C(/c1ccc(Oc2cc(Oc3ccc(C(=O)N(C)C)cc3)cc(C(=O)NC3CCC(NC(=O)OC(C)(C)C)CC3)c2)cc1)N(O)C(C)=O |
| InChI | InChI=1S/C36H43N5O8/c1-22(42)41(46)32(37)23-7-15-28(16-8-23)47-30-19-25(20-31(21-30)48-29-17-9-24(10-18-29)34(44)40(5)6)33(43)38-26-11-13-27(14-12-26)39-35(45)49-36(2,3)4/h7-10,15-21,26-27,37,46H,11-14H2,1-6H3,(H,38,43)(H,39,45)/b37-32- |
| InChIKey | FYPFTPUNDBNAOH-FTTXPQLCSA-N |
| XLogP | 6.10 |
| TPSA | 170.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.77 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|