C32H37N7O7 — CID 90994799
2,6-bis[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]-N-(1-propylpiperidin-4-yl)pyridine-4-carboxamide (PubChem CID 90994799) has the molecular formula C32H37N7O7 and a molecular weight of 631.69 g/mol. Its IUPAC name is 2,6-bis[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]-N-(1-propylpiperidin-4-yl)pyridine-4-carboxamide.
| Compound Name | 2,6-bis[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]-N-(1-propylpiperidin-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 90994799 |
| Molecular Formula | C32H37N7O7 |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | 2,6-bis[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]-N-(1-propylpiperidin-4-yl)pyridine-4-carboxamide |
| SMILES | [H]/N=C(/c1ccc(Oc2cc(C(=O)NC3CCN(CCC)CC3)cc(Oc3ccc(/C(=N/[H])N(O)C(C)=O)cc3)n2)cc1)N(O)C(C)=O |
| InChI | InChI=1S/C32H37N7O7/c1-4-15-37-16-13-25(14-17-37)35-32(42)24-18-28(45-26-9-5-22(6-10-26)30(33)38(43)20(2)40)36-29(19-24)46-27-11-7-23(8-12-27)31(34)39(44)21(3)41/h5-12,18-19,25,33-34,43-44H,4,13-17H2,1-3H3,(H,35,42)/b33-30-,34-31- |
| InChIKey | SCXXHFKBFDVILN-IEJIULPBSA-N |
| XLogP | 4.40 |
| TPSA | 192.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|